C13H12FIN2O2 — CID 79788186
1-ethyl-3-[(2-fluorophenyl)methyl]-5-iodopyrimidine-2,4-dione (PubChem CID 79788186) has the molecular formula C13H12FIN2O2 and a molecular weight of 374.15 g/mol. Its IUPAC name is 1-ethyl-3-[(2-fluorophenyl)methyl]-5-iodopyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-[(2-fluorophenyl)methyl]-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 79788186 |
| Molecular Formula | C13H12FIN2O2 |
| Molecular Weight | 374.15 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 1-ethyl-3-[(2-fluorophenyl)methyl]-5-iodopyrimidine-2,4-dione |
| SMILES | CCn1cc(I)c(=O)n(Cc2ccccc2F)c1=O |
| InChI | InChI=1S/C13H12FIN2O2/c1-2-16-8-11(15)12(18)17(13(16)19)7-9-5-3-4-6-10(9)14/h3-6,8H,2,7H2,1H3 |
| InChIKey | PKMJXVVDXDCFFS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.15 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|