C14H13F2IN2O2 — CID 116790908
3-(2,2-difluoro-2-phenylethyl)-1-ethyl-5-iodopyrimidine-2,4-dione (PubChem CID 116790908) has the molecular formula C14H13F2IN2O2 and a molecular weight of 406.17 g/mol. Its IUPAC name is 3-(2,2-difluoro-2-phenylethyl)-1-ethyl-5-iodopyrimidine-2,4-dione.
| Compound Name | 3-(2,2-difluoro-2-phenylethyl)-1-ethyl-5-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 116790908 |
| Molecular Formula | C14H13F2IN2O2 |
| Molecular Weight | 406.17 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 3-(2,2-difluoro-2-phenylethyl)-1-ethyl-5-iodopyrimidine-2,4-dione |
| SMILES | CCn1cc(I)c(=O)n(CC(F)(F)c2ccccc2)c1=O |
| InChI | InChI=1S/C14H13F2IN2O2/c1-2-18-8-11(17)12(20)19(13(18)21)9-14(15,16)10-6-4-3-5-7-10/h3-8H,2,9H2,1H3 |
| InChIKey | PFXLSDOGFCUPOE-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|