C15H17F2N — CID 116790655
1-(2,2-difluoro-2-phenylethyl)-2,3,4-trimethylpyrrole (PubChem CID 116790655) has the molecular formula C15H17F2N and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-(2,2-difluoro-2-phenylethyl)-2,3,4-trimethylpyrrole.
| Compound Name | 1-(2,2-difluoro-2-phenylethyl)-2,3,4-trimethylpyrrole |
|---|---|
| PubChem CID | 116790655 |
| Molecular Formula | C15H17F2N |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(2,2-difluoro-2-phenylethyl)-2,3,4-trimethylpyrrole |
| SMILES | Cc1cn(CC(F)(F)c2ccccc2)c(C)c1C |
| InChI | InChI=1S/C15H17F2N/c1-11-9-18(13(3)12(11)2)10-15(16,17)14-7-5-4-6-8-14/h4-9H,10H2,1-3H3 |
| InChIKey | KNRLJQDIXIZBFD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |