C9H9N3OS — CID 79794027
6-[(1,3-thiazol-2-ylamino)methyl]pyridin-3-ol (PubChem CID 79794027) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 6-[(1,3-thiazol-2-ylamino)methyl]pyridin-3-ol.
| Compound Name | 6-[(1,3-thiazol-2-ylamino)methyl]pyridin-3-ol |
|---|---|
| PubChem CID | 79794027 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 6-[(1,3-thiazol-2-ylamino)methyl]pyridin-3-ol |
| SMILES | Oc1ccc(CNc2nccs2)nc1 |
| InChI | InChI=1S/C9H9N3OS/c13-8-2-1-7(11-6-8)5-12-9-10-3-4-14-9/h1-4,6,13H,5H2,(H,10,12) |
| InChIKey | OZDPPOJBFLJBLD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |