C8H12F3NO2 — CID 79801710
3,3,3-trifluoro-2-methyl-2-pyrrolidin-1-ylpropanoic acid (PubChem CID 79801710) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-pyrrolidin-1-ylpropanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-pyrrolidin-1-ylpropanoic acid |
|---|---|
| PubChem CID | 79801710 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-pyrrolidin-1-ylpropanoic acid |
| SMILES | CC(C(=O)O)(N1CCCC1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-7(6(13)14,8(9,10)11)12-4-2-3-5-12/h2-5H2,1H3,(H,13,14) |
| InChIKey | IVMSKPVZISKSSV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |