C9H8F4N4 — CID 79822033
N-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridin-5-amine (PubChem CID 79822033) has the molecular formula C9H8F4N4 and a molecular weight of 248.18 g/mol. Its IUPAC name is N-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridin-5-amine.
| Compound Name | N-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 79822033 |
| Molecular Formula | C9H8F4N4 |
| Molecular Weight | 248.18 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridin-5-amine |
| SMILES | CNc1ccc2[nH]c(C(F)(F)C(F)F)nc2n1 |
| InChI | InChI=1S/C9H8F4N4/c1-14-5-3-2-4-6(16-5)17-8(15-4)9(12,13)7(10)11/h2-3,7H,1H3,(H2,14,15,16,17) |
| InChIKey | OZOHLXQWLNLICP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.18 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|