C9H7F4N3 — CID 81137371
5-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 81137371) has the molecular formula C9H7F4N3 and a molecular weight of 233.17 g/mol. Its IUPAC name is 5-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 81137371 |
| Molecular Formula | C9H7F4N3 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-methyl-2-(1,1,2,2-tetrafluoroethyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | Cc1ccc2[nH]c(C(F)(F)C(F)F)nc2n1 |
| InChI | InChI=1S/C9H7F4N3/c1-4-2-3-5-6(14-4)16-8(15-5)9(12,13)7(10)11/h2-3,7H,1H3,(H,14,15,16) |
| InChIKey | WWEZSUVKYWMKQM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|