C15H15F2NO2S — CID 79834904
methyl 2,3-difluoro-4-(1-thiophen-2-ylpropan-2-ylamino)benzoate (PubChem CID 79834904) has the molecular formula C15H15F2NO2S and a molecular weight of 311.35 g/mol. Its IUPAC name is methyl 2,3-difluoro-4-(1-thiophen-2-ylpropan-2-ylamino)benzoate.
| Compound Name | methyl 2,3-difluoro-4-(1-thiophen-2-ylpropan-2-ylamino)benzoate |
|---|---|
| PubChem CID | 79834904 |
| Molecular Formula | C15H15F2NO2S |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | methyl 2,3-difluoro-4-(1-thiophen-2-ylpropan-2-ylamino)benzoate |
| SMILES | COC(=O)c1ccc(NC(C)Cc2cccs2)c(F)c1F |
| InChI | InChI=1S/C15H15F2NO2S/c1-9(8-10-4-3-7-21-10)18-12-6-5-11(15(19)20-2)13(16)14(12)17/h3-7,9,18H,8H2,1-2H3 |
| InChIKey | ZWSBIBMCGYZOLR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |