C22H25N4O2+ — CID 7986952
(2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-quinoxalin-2-yloxypropan-1-one (PubChem CID 7986952) has the molecular formula C22H25N4O2+ and a molecular weight of 377.47 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-quinoxalin-2-yloxypropan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-quinoxalin-2-yloxypropan-1-one |
|---|---|
| PubChem CID | 7986952 |
| Molecular Formula | C22H25N4O2+ |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-quinoxalin-2-yloxypropan-1-one |
| SMILES | C[C@H](Oc1cnc2ccccc2n1)C(=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H24N4O2/c1-17(28-21-15-23-19-9-5-6-10-20(19)24-21)22(27)26-13-11-25(12-14-26)16-18-7-3-2-4-8-18/h2-10,15,17H,11-14,16H2,1H3/p+1/t17-/m0/s1 |
| InChIKey | XZZIIDPOIYTDOZ-KRWDZBQOSA-O |
| XLogP | 1.32 |
| TPSA | 59.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |