C23H30N3O3+ — CID 7669969
(2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxypropan-1-one (PubChem CID 7669969) has the molecular formula C23H30N3O3+ and a molecular weight of 396.51 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxypropan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxypropan-1-one |
|---|---|
| PubChem CID | 7669969 |
| Molecular Formula | C23H30N3O3+ |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-ethoxyphenyl)methylideneamino]oxypropan-1-one |
| SMILES | CCOc1ccc(/C=N\O[C@H](C)C(=O)N2CC[NH+](Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-3-28-22-11-9-20(10-12-22)17-24-29-19(2)23(27)26-15-13-25(14-16-26)18-21-7-5-4-6-8-21/h4-12,17,19H,3,13-16,18H2,1-2H3/p+1/b24-17-/t19-/m1/s1 |
| InChIKey | NIFOKQBEMPRYJW-RJDQKLELSA-O |
| XLogP | 1.75 |
| TPSA | 55.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|