C21H25ClN3O2+ — CID 7701118
(2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-chlorophenyl)methylideneamino]oxypropan-1-one (PubChem CID 7701118) has the molecular formula C21H25ClN3O2+ and a molecular weight of 386.90 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-chlorophenyl)methylideneamino]oxypropan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-chlorophenyl)methylideneamino]oxypropan-1-one |
|---|---|
| PubChem CID | 7701118 |
| Molecular Formula | C21H25ClN3O2+ |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-4-ium-1-yl)-2-[(Z)-(4-chlorophenyl)methylideneamino]oxypropan-1-one |
| SMILES | C[C@H](O/N=C\c1ccc(Cl)cc1)C(=O)N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H24ClN3O2/c1-17(27-23-15-18-7-9-20(22)10-8-18)21(26)25-13-11-24(12-14-25)16-19-5-3-2-4-6-19/h2-10,15,17H,11-14,16H2,1H3/p+1/b23-15-/t17-/m0/s1 |
| InChIKey | RIKNENVALGNJPT-XYLCRUHJSA-O |
| XLogP | 2.01 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|