C22H29N2O2+ — CID 9173154
(2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(3,5-dimethylphenoxy)propan-1-one (PubChem CID 9173154) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(3,5-dimethylphenoxy)propan-1-one.
| Compound Name | (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(3,5-dimethylphenoxy)propan-1-one |
|---|---|
| PubChem CID | 9173154 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (2R)-1-(4-benzylpiperazin-4-ium-1-yl)-2-(3,5-dimethylphenoxy)propan-1-one |
| SMILES | Cc1cc(C)cc(O[C@H](C)C(=O)N2CC[NH+](Cc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-17-13-18(2)15-21(14-17)26-19(3)22(25)24-11-9-23(10-12-24)16-20-7-5-4-6-8-20/h4-8,13-15,19H,9-12,16H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | UMTUSDUXBBOJON-LJQANCHMSA-O |
| XLogP | 2.00 |
| TPSA | 33.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |