C13H18N4O3 — CID 79880954
2-ethyl-2-N-(6-nitro-1,3-benzoxazol-2-yl)butane-1,2-diamine (PubChem CID 79880954) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-ethyl-2-N-(6-nitro-1,3-benzoxazol-2-yl)butane-1,2-diamine.
| Compound Name | 2-ethyl-2-N-(6-nitro-1,3-benzoxazol-2-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 79880954 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-ethyl-2-N-(6-nitro-1,3-benzoxazol-2-yl)butane-1,2-diamine |
| SMILES | CCC(CC)(CN)Nc1nc2ccc([N+](=O)[O-])cc2o1 |
| InChI | InChI=1S/C13H18N4O3/c1-3-13(4-2,8-14)16-12-15-10-6-5-9(17(18)19)7-11(10)20-12/h5-7H,3-4,8,14H2,1-2H3,(H,15,16) |
| InChIKey | ZMNVEHJZDBGCQI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|