C16H14N4O — CID 79881622
2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-5-amine (PubChem CID 79881622) has the molecular formula C16H14N4O and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 79881622 |
| Molecular Formula | C16H14N4O |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-(5,6-dimethylbenzimidazol-1-yl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1cc2ncn(-c3nc4cc(N)ccc4o3)c2cc1C |
| InChI | InChI=1S/C16H14N4O/c1-9-5-12-14(6-10(9)2)20(8-18-12)16-19-13-7-11(17)3-4-15(13)21-16/h3-8H,17H2,1-2H3 |
| InChIKey | BFLWZPRTMCYDLE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|