C11H17NO5S — CID 79886245
methyl 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-ethylbut-2-enoate (PubChem CID 79886245) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is methyl 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-ethylbut-2-enoate.
| Compound Name | methyl 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-ethylbut-2-enoate |
|---|---|
| PubChem CID | 79886245 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | methyl 4-(4,4-dimethyl-1,1,3-trioxothiazetidin-2-yl)-2-ethylbut-2-enoate |
| SMILES | CCC(=CCN1C(=O)C(C)(C)S1(=O)=O)C(=O)OC |
| InChI | InChI=1S/C11H17NO5S/c1-5-8(9(13)17-4)6-7-12-10(14)11(2,3)18(12,15)16/h6H,5,7H2,1-4H3 |
| InChIKey | CTSWMGFOOFWIKR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|