C11H14BrNO6S2 — CID 79923482
methyl 2-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate (PubChem CID 79923482) has the molecular formula C11H14BrNO6S2 and a molecular weight of 400.27 g/mol. Its IUPAC name is methyl 2-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate.
| Compound Name | methyl 2-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate |
|---|---|
| PubChem CID | 79923482 |
| Molecular Formula | C11H14BrNO6S2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 398.94 |
| IUPAC Name | methyl 2-[(5-bromo-4-methylthiophen-2-yl)sulfonyl-(2-methoxy-2-oxoethyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)S(=O)(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C11H14BrNO6S2/c1-7-4-10(20-11(7)12)21(16,17)13(5-8(14)18-2)6-9(15)19-3/h4H,5-6H2,1-3H3 |
| InChIKey | NPTVCSDSWNILOK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |