C15H22BrNO3S — CID 79987712
methyl 2-[(5-bromo-4-methylthiophene-2-carbonyl)-(2-ethylbutyl)amino]acetate (PubChem CID 79987712) has the molecular formula C15H22BrNO3S and a molecular weight of 376.32 g/mol. Its IUPAC name is methyl 2-[(5-bromo-4-methylthiophene-2-carbonyl)-(2-ethylbutyl)amino]acetate.
| Compound Name | methyl 2-[(5-bromo-4-methylthiophene-2-carbonyl)-(2-ethylbutyl)amino]acetate |
|---|---|
| PubChem CID | 79987712 |
| Molecular Formula | C15H22BrNO3S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | methyl 2-[(5-bromo-4-methylthiophene-2-carbonyl)-(2-ethylbutyl)amino]acetate |
| SMILES | CCC(CC)CN(CC(=O)OC)C(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C15H22BrNO3S/c1-5-11(6-2)8-17(9-13(18)20-4)15(19)12-7-10(3)14(16)21-12/h7,11H,5-6,8-9H2,1-4H3 |
| InChIKey | BZWQFDHRNVMXBP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |