C14H23BrO2 — CID 79924284
4-(3-bromocyclopentyl)-1,9-dioxaspiro[5.5]undecane (PubChem CID 79924284) has the molecular formula C14H23BrO2 and a molecular weight of 303.24 g/mol. Its IUPAC name is 4-(3-bromocyclopentyl)-1,9-dioxaspiro[5.5]undecane.
| Compound Name | 4-(3-bromocyclopentyl)-1,9-dioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79924284 |
| Molecular Formula | C14H23BrO2 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-(3-bromocyclopentyl)-1,9-dioxaspiro[5.5]undecane |
| SMILES | BrC1CCC(C2CCOC3(CCOCC3)C2)C1 |
| InChI | InChI=1S/C14H23BrO2/c15-13-2-1-11(9-13)12-3-6-17-14(10-12)4-7-16-8-5-14/h11-13H,1-10H2 |
| InChIKey | IJMKXHPTIGKXNN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|