C9H17NO2S — CID 79950237
ethyl 5-methyl-3-(methylamino)thiolane-3-carboxylate (PubChem CID 79950237) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is ethyl 5-methyl-3-(methylamino)thiolane-3-carboxylate.
| Compound Name | ethyl 5-methyl-3-(methylamino)thiolane-3-carboxylate |
|---|---|
| PubChem CID | 79950237 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | ethyl 5-methyl-3-(methylamino)thiolane-3-carboxylate |
| SMILES | CCOC(=O)C1(NC)CSC(C)C1 |
| InChI | InChI=1S/C9H17NO2S/c1-4-12-8(11)9(10-3)5-7(2)13-6-9/h7,10H,4-6H2,1-3H3 |
| InChIKey | MRJBOSGGINCIOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |