About 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide (PubChem CID 79958259) has the molecular formula C10H11BrN4OS
and a molecular weight of 315.20 g/mol. Its IUPAC name is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide.
Analyze 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide?
The IUPAC name of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide (CID 79958259) is 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide.
What is the SMILES notation for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide?
The canonical SMILES for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide is O=S1CCN(c2nc(Br)cn3ccnc23)CC1.
What is the InChIKey of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide?
The InChIKey is YWGDUQXZNORDQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN4OS/c11-8-7-15-2-1-12-9(15)10(13-8)14-3-5-17(16)6-4-14/h1-2,7H,3-6H2.
What are the key properties of 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide?
4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide has a molecular weight of 315.20 g/mol, XLogP of 1.06, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-bromoimidazo[1,2-a]pyrazin-8-yl)-1,4-thiazinane 1-oxide is sourced from PubChem (CID 79958259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).