C18H26N2O4 — CID 7998322
methyl 3-[(2R)-3-[2-cyanoethyl(2-methylpropyl)amino]-2-hydroxypropoxy]benzoate (PubChem CID 7998322) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl 3-[(2R)-3-[2-cyanoethyl(2-methylpropyl)amino]-2-hydroxypropoxy]benzoate.
| Compound Name | methyl 3-[(2R)-3-[2-cyanoethyl(2-methylpropyl)amino]-2-hydroxypropoxy]benzoate |
|---|---|
| PubChem CID | 7998322 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | methyl 3-[(2R)-3-[2-cyanoethyl(2-methylpropyl)amino]-2-hydroxypropoxy]benzoate |
| SMILES | COC(=O)c1cccc(OC[C@H](O)CN(CCC#N)CC(C)C)c1 |
| InChI | InChI=1S/C18H26N2O4/c1-14(2)11-20(9-5-8-19)12-16(21)13-24-17-7-4-6-15(10-17)18(22)23-3/h4,6-7,10,14,16,21H,5,9,11-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | ULGWJAFIIXZFNX-MRXNPFEDSA-N |
| XLogP | 2.08 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |