C16H10N4O3S — CID 7998465
N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide (PubChem CID 7998465) has the molecular formula C16H10N4O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 7998465 |
| Molecular Formula | C16H10N4O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | N-[4,5-bis(furan-2-yl)-1,3-thiazol-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccco2)c(-c2ccco2)s1)c1cnccn1 |
| InChI | InChI=1S/C16H10N4O3S/c21-15(10-9-17-5-6-18-10)20-16-19-13(11-3-1-7-22-11)14(24-16)12-4-2-8-23-12/h1-9H,(H,19,20,21) |
| InChIKey | RZWKZIBNIIKMEP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |