C14H18N2 — CID 79984796
1-(4-cyclopropylphenyl)-N-prop-2-ynylethane-1,2-diamine (PubChem CID 79984796) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(4-cyclopropylphenyl)-N-prop-2-ynylethane-1,2-diamine.
| Compound Name | 1-(4-cyclopropylphenyl)-N-prop-2-ynylethane-1,2-diamine |
|---|---|
| PubChem CID | 79984796 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(4-cyclopropylphenyl)-N-prop-2-ynylethane-1,2-diamine |
| SMILES | C#CCNC(CN)c1ccc(C2CC2)cc1 |
| InChI | InChI=1S/C14H18N2/c1-2-9-16-14(10-15)13-7-5-12(6-8-13)11-3-4-11/h1,5-8,11,14,16H,3-4,9-10,15H2 |
| InChIKey | UXRKXWLKLNBVOZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|