C16H15NO2S — CID 79985526
6-(3-ethylthiophene-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 79985526) has the molecular formula C16H15NO2S and a molecular weight of 285.37 g/mol. Its IUPAC name is 6-(3-ethylthiophene-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6-(3-ethylthiophene-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 79985526 |
| Molecular Formula | C16H15NO2S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 6-(3-ethylthiophene-2-carbonyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | CCc1ccsc1C(=O)c1ccc2c(c1)CCC(=O)N2 |
| InChI | InChI=1S/C16H15NO2S/c1-2-10-7-8-20-16(10)15(19)12-3-5-13-11(9-12)4-6-14(18)17-13/h3,5,7-9H,2,4,6H2,1H3,(H,17,18) |
| InChIKey | YGMGQBCSNGNMLB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |