C19H34N2 — CID 79987873
1-(3,5-dimethyl-1-adamantyl)-2,5,5-trimethylpiperazine (PubChem CID 79987873) has the molecular formula C19H34N2 and a molecular weight of 290.50 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)-2,5,5-trimethylpiperazine.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)-2,5,5-trimethylpiperazine |
|---|---|
| PubChem CID | 79987873 |
| Molecular Formula | C19H34N2 |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.27 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)-2,5,5-trimethylpiperazine |
| SMILES | CC1CNC(C)(C)CN1C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C19H34N2/c1-14-9-20-16(2,3)13-21(14)19-8-15-6-17(4,11-19)10-18(5,7-15)12-19/h14-15,20H,6-13H2,1-5H3 |
| InChIKey | MFJXILJYSBZVQV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |