C14H30N2 — CID 65043445
1-(3-ethylpentan-3-yl)-2,5,5-trimethylpiperazine (PubChem CID 65043445) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-(3-ethylpentan-3-yl)-2,5,5-trimethylpiperazine.
| Compound Name | 1-(3-ethylpentan-3-yl)-2,5,5-trimethylpiperazine |
|---|---|
| PubChem CID | 65043445 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | 1-(3-ethylpentan-3-yl)-2,5,5-trimethylpiperazine |
| SMILES | CCC(CC)(CC)N1CC(C)(C)NCC1C |
| InChI | InChI=1S/C14H30N2/c1-7-14(8-2,9-3)16-11-13(5,6)15-10-12(16)4/h12,15H,7-11H2,1-6H3 |
| InChIKey | KQVGRLVLTCDVLP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |