C11H22N2O — CID 82241166
2-methyl-1-(2,5,5-trimethylpiperazin-1-yl)propan-1-one (PubChem CID 82241166) has the molecular formula C11H22N2O and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-methyl-1-(2,5,5-trimethylpiperazin-1-yl)propan-1-one.
| Compound Name | 2-methyl-1-(2,5,5-trimethylpiperazin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 82241166 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.17 |
| IUPAC Name | 2-methyl-1-(2,5,5-trimethylpiperazin-1-yl)propan-1-one |
| SMILES | CC(C)C(=O)N1CC(C)(C)NCC1C |
| InChI | InChI=1S/C11H22N2O/c1-8(2)10(14)13-7-11(4,5)12-6-9(13)3/h8-9,12H,6-7H2,1-5H3 |
| InChIKey | LXUGQUMJEUHNSR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |