C13H28N2 — CID 64934237
2,5,5-trimethyl-1-(4-methylpentan-2-yl)piperazine (PubChem CID 64934237) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 2,5,5-trimethyl-1-(4-methylpentan-2-yl)piperazine.
| Compound Name | 2,5,5-trimethyl-1-(4-methylpentan-2-yl)piperazine |
|---|---|
| PubChem CID | 64934237 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 2,5,5-trimethyl-1-(4-methylpentan-2-yl)piperazine |
| SMILES | CC(C)CC(C)N1CC(C)(C)NCC1C |
| InChI | InChI=1S/C13H28N2/c1-10(2)7-11(3)15-9-13(5,6)14-8-12(15)4/h10-12,14H,7-9H2,1-6H3 |
| InChIKey | WFIFKPJHBUUKAM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |