C23H26NO2+ — CID 7998801
benzhydryl-[(2,3-dimethoxyphenyl)methyl]-methylazanium (PubChem CID 7998801) has the molecular formula C23H26NO2+ and a molecular weight of 348.47 g/mol. Its IUPAC name is benzhydryl-[(2,3-dimethoxyphenyl)methyl]-methylazanium.
| Compound Name | benzhydryl-[(2,3-dimethoxyphenyl)methyl]-methylazanium |
|---|---|
| PubChem CID | 7998801 |
| Molecular Formula | C23H26NO2+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | benzhydryl-[(2,3-dimethoxyphenyl)methyl]-methylazanium |
| SMILES | COc1cccc(C[NH+](C)C(c2ccccc2)c2ccccc2)c1OC |
| InChI | InChI=1S/C23H25NO2/c1-24(17-20-15-10-16-21(25-2)23(20)26-3)22(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-16,22H,17H2,1-3H3/p+1 |
| InChIKey | PBKFAELENIOZSQ-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 22.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |