C19H28N3O5- — CID 8008975
(2S)-2-[[(2R)-2-(adamantane-2-carbonylamino)propanoyl]amino]-5-amino-5-oxopentanoate (PubChem CID 8008975) has the molecular formula C19H28N3O5- and a molecular weight of 378.45 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-(adamantane-2-carbonylamino)propanoyl]amino]-5-amino-5-oxopentanoate.
| Compound Name | (2S)-2-[[(2R)-2-(adamantane-2-carbonylamino)propanoyl]amino]-5-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 8008975 |
| Molecular Formula | C19H28N3O5- |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (2S)-2-[[(2R)-2-(adamantane-2-carbonylamino)propanoyl]amino]-5-amino-5-oxopentanoate |
| SMILES | C[C@@H](NC(=O)C1C2CC3CC(C2)CC1C3)C(=O)N[C@@H](CCC(N)=O)C(=O)[O-] |
| InChI | InChI=1S/C19H29N3O5/c1-9(17(24)22-14(19(26)27)2-3-15(20)23)21-18(25)16-12-5-10-4-11(7-12)8-13(16)6-10/h9-14,16H,2-8H2,1H3,(H2,20,23)(H,21,25)(H,22,24)(H,26,27)/p-1/t9-,10?,11?,12?,13?,14+,16?/m1/s1 |
| InChIKey | ZEGUMFFADBKMSG-LSPCLFAPSA-M |
| XLogP | -0.94 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |