About 1-benzylperimidine
1-benzylperimidine (PubChem CID 801168) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is 1-benzylperimidine.
Molecular Properties
| Compound Name | 1-benzylperimidine |
| PubChem CID | 801168 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-benzylperimidine |
| SMILES | C1=Nc2cccc3cccc(c23)N1Cc1ccccc1 |
| InChI | InChI=1S/C18H14N2/c1-2-6-14(7-3-1)12-20-13-19-16-10-4-8-15-9-5-11-17(20)18(15)16/h1-11,13H,12H2 |
| InChIKey | GBKRMIILRHCQSR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylperimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylperimidine?
The IUPAC name of 1-benzylperimidine (CID 801168) is 1-benzylperimidine.
What is the SMILES notation for 1-benzylperimidine?
The canonical SMILES for 1-benzylperimidine is C1=Nc2cccc3cccc(c23)N1Cc1ccccc1.
What is the InChIKey of 1-benzylperimidine?
The InChIKey is GBKRMIILRHCQSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c1-2-6-14(7-3-1)12-20-13-19-16-10-4-8-15-9-5-11-17(20)18(15)16/h1-11,13H,12H2.
What are the key properties of 1-benzylperimidine?
1-benzylperimidine has a molecular weight of 258.32 g/mol, XLogP of 4.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylperimidine is sourced from PubChem (CID 801168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).