C18H15Cl2N3O2 — CID 8012479
2-(6,8-dichloroquinazolin-4-yl)oxy-N-(2,5-dimethylphenyl)acetamide (PubChem CID 8012479) has the molecular formula C18H15Cl2N3O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(6,8-dichloroquinazolin-4-yl)oxy-N-(2,5-dimethylphenyl)acetamide.
| Compound Name | 2-(6,8-dichloroquinazolin-4-yl)oxy-N-(2,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 8012479 |
| Molecular Formula | C18H15Cl2N3O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 2-(6,8-dichloroquinazolin-4-yl)oxy-N-(2,5-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2ncnc3c(Cl)cc(Cl)cc23)c1 |
| InChI | InChI=1S/C18H15Cl2N3O2/c1-10-3-4-11(2)15(5-10)23-16(24)8-25-18-13-6-12(19)7-14(20)17(13)21-9-22-18/h3-7,9H,8H2,1-2H3,(H,23,24) |
| InChIKey | PRJQTMYZSYPQNO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |