C11H14N2O3 — CID 8020916
[2-(2-cyanoethylamino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate (PubChem CID 8020916) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is [2-(2-cyanoethylamino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate.
| Compound Name | [2-(2-cyanoethylamino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 8020916 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [2-(2-cyanoethylamino)-2-oxoethyl] (2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)OCC(=O)NCCC#N |
| InChI | InChI=1S/C11H14N2O3/c1-2-3-4-6-11(15)16-9-10(14)13-8-5-7-12/h2-4,6H,5,8-9H2,1H3,(H,13,14)/b3-2+,6-4+ |
| InChIKey | VGOTZSNLLZLNFJ-WJPDYIDTSA-N |
| XLogP | 0.69 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|