C16H19N3O5 — CID 8023469
(3-cyano-4-imino-2-oxopentyl) 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 8023469) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is (3-cyano-4-imino-2-oxopentyl) 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | (3-cyano-4-imino-2-oxopentyl) 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 8023469 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | (3-cyano-4-imino-2-oxopentyl) 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | [H]/N=C(\C)C(C#N)C(=O)COC(=O)CN1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C16H19N3O5/c1-9(18)12(6-17)13(20)8-24-14(21)7-19-15(22)10-4-2-3-5-11(10)16(19)23/h10-12,18H,2-5,7-8H2,1H3/b18-9+/t10-,11-,12?/m1/s1 |
| InChIKey | BTIAAXZBZSSGNY-PZOYGKADSA-N |
| XLogP | 0.45 |
| TPSA | 128.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|