C11H11F3N2O — CID 8025304
1,1,1-trifluoro-4-(pyridin-2-ylmethylimino)pentan-2-one (PubChem CID 8025304) has the molecular formula C11H11F3N2O and a molecular weight of 244.22 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(pyridin-2-ylmethylimino)pentan-2-one.
| Compound Name | 1,1,1-trifluoro-4-(pyridin-2-ylmethylimino)pentan-2-one |
|---|---|
| PubChem CID | 8025304 |
| Molecular Formula | C11H11F3N2O |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1,1,1-trifluoro-4-(pyridin-2-ylmethylimino)pentan-2-one |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\Cc1ccccn1 |
| InChI | InChI=1S/C11H11F3N2O/c1-8(6-10(17)11(12,13)14)16-7-9-4-2-3-5-15-9/h2-5H,6-7H2,1H3/b16-8+ |
| InChIKey | XEGBJLVOSMDCGL-LZYBPNLTSA-N |
| XLogP | 2.56 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|