C15H25N5S — CID 80512416
3-(2,6-dimethylthiomorpholin-4-yl)-5,6-diethylpyridazine-4-carboximidamide (PubChem CID 80512416) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is 3-(2,6-dimethylthiomorpholin-4-yl)-5,6-diethylpyridazine-4-carboximidamide.
| Compound Name | 3-(2,6-dimethylthiomorpholin-4-yl)-5,6-diethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80512416 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-(2,6-dimethylthiomorpholin-4-yl)-5,6-diethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N2CC(C)SC(C)C2)nnc(CC)c1CC |
| InChI | InChI=1S/C15H25N5S/c1-5-11-12(6-2)18-19-15(13(11)14(16)17)20-7-9(3)21-10(4)8-20/h9-10H,5-8H2,1-4H3,(H3,16,17) |
| InChIKey | ZROGTXCRHXHZTN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|