C15H27N5 — CID 80513125
3-(dipropylamino)-5,6-diethylpyridazine-4-carboximidamide (PubChem CID 80513125) has the molecular formula C15H27N5 and a molecular weight of 277.42 g/mol. Its IUPAC name is 3-(dipropylamino)-5,6-diethylpyridazine-4-carboximidamide.
| Compound Name | 3-(dipropylamino)-5,6-diethylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513125 |
| Molecular Formula | C15H27N5 |
| Molecular Weight | 277.42 g/mol |
| Exact Mass | 277.23 |
| IUPAC Name | 3-(dipropylamino)-5,6-diethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N(CCC)CCC)nnc(CC)c1CC |
| InChI | InChI=1S/C15H27N5/c1-5-9-20(10-6-2)15-13(14(16)17)11(7-3)12(8-4)18-19-15/h5-10H2,1-4H3,(H3,16,17) |
| InChIKey | LBNQKJLNQOLBFZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|