C13H22N4OS — CID 80515382
5,6-diethyl-3-(4-hydroxybutan-2-ylsulfanyl)pyridazine-4-carboximidamide (PubChem CID 80515382) has the molecular formula C13H22N4OS and a molecular weight of 282.41 g/mol. Its IUPAC name is 5,6-diethyl-3-(4-hydroxybutan-2-ylsulfanyl)pyridazine-4-carboximidamide.
| Compound Name | 5,6-diethyl-3-(4-hydroxybutan-2-ylsulfanyl)pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80515382 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 5,6-diethyl-3-(4-hydroxybutan-2-ylsulfanyl)pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC(C)CCO)nnc(CC)c1CC |
| InChI | InChI=1S/C13H22N4OS/c1-4-9-10(5-2)16-17-13(11(9)12(14)15)19-8(3)6-7-18/h8,18H,4-7H2,1-3H3,(H3,14,15) |
| InChIKey | QRSYGKCDMYOVQE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|