C14H25N5 — CID 80513182
5,6-diethyl-3-[ethyl(propan-2-yl)amino]pyridazine-4-carboximidamide (PubChem CID 80513182) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 5,6-diethyl-3-[ethyl(propan-2-yl)amino]pyridazine-4-carboximidamide.
| Compound Name | 5,6-diethyl-3-[ethyl(propan-2-yl)amino]pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513182 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 5,6-diethyl-3-[ethyl(propan-2-yl)amino]pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N(CC)C(C)C)nnc(CC)c1CC |
| InChI | InChI=1S/C14H25N5/c1-6-10-11(7-2)17-18-14(12(10)13(15)16)19(8-3)9(4)5/h9H,6-8H2,1-5H3,(H3,15,16) |
| InChIKey | MTCLCGWFRGUNPZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|