About 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide
3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide (PubChem CID 80515568) has the molecular formula C13H22N4S
and a molecular weight of 266.41 g/mol. Its IUPAC name is 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide.
Molecular Properties
| Compound Name | 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide |
| PubChem CID | 80515568 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(SC(C)CC)nnc(CC)c1CC |
| InChI | InChI=1S/C13H22N4S/c1-5-8(4)18-13-11(12(14)15)9(6-2)10(7-3)16-17-13/h8H,5-7H2,1-4H3,(H3,14,15) |
| InChIKey | RFRFOILJMYUZSX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide?
The IUPAC name of 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide (CID 80515568) is 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide.
What is the SMILES notation for 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide?
The canonical SMILES for 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide is [H]/N=C(\N)c1c(SC(C)CC)nnc(CC)c1CC.
What is the InChIKey of 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide?
The InChIKey is RFRFOILJMYUZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4S/c1-5-8(4)18-13-11(12(14)15)9(6-2)10(7-3)16-17-13/h8H,5-7H2,1-4H3,(H3,14,15).
What are the key properties of 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide?
3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide has a molecular weight of 266.41 g/mol, XLogP of 2.78, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-ylsulfanyl-5,6-diethylpyridazine-4-carboximidamide is sourced from PubChem (CID 80515568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).