C13H21N5S — CID 80513327
5,6-diethyl-3-thiomorpholin-4-ylpyridazine-4-carboximidamide (PubChem CID 80513327) has the molecular formula C13H21N5S and a molecular weight of 279.41 g/mol. Its IUPAC name is 5,6-diethyl-3-thiomorpholin-4-ylpyridazine-4-carboximidamide.
| Compound Name | 5,6-diethyl-3-thiomorpholin-4-ylpyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513327 |
| Molecular Formula | C13H21N5S |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 5,6-diethyl-3-thiomorpholin-4-ylpyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(N2CCSCC2)nnc(CC)c1CC |
| InChI | InChI=1S/C13H21N5S/c1-3-9-10(4-2)16-17-13(11(9)12(14)15)18-5-7-19-8-6-18/h3-8H2,1-2H3,(H3,14,15) |
| InChIKey | UZBFORHLWVYYDO-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 78.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|