C14H20N6 — CID 80513406
5,6-diethyl-3-(2-ethylimidazol-1-yl)pyridazine-4-carboximidamide (PubChem CID 80513406) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 5,6-diethyl-3-(2-ethylimidazol-1-yl)pyridazine-4-carboximidamide.
| Compound Name | 5,6-diethyl-3-(2-ethylimidazol-1-yl)pyridazine-4-carboximidamide |
|---|---|
| PubChem CID | 80513406 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5,6-diethyl-3-(2-ethylimidazol-1-yl)pyridazine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(-n2ccnc2CC)nnc(CC)c1CC |
| InChI | InChI=1S/C14H20N6/c1-4-9-10(5-2)18-19-14(12(9)13(15)16)20-8-7-17-11(20)6-3/h7-8H,4-6H2,1-3H3,(H3,15,16) |
| InChIKey | JIEHTYMERNETOI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|