C13H15N5 — CID 80514429
5,6-diethyl-3-(pyrrol-1-ylamino)pyridazine-4-carbonitrile (PubChem CID 80514429) has the molecular formula C13H15N5 and a molecular weight of 241.30 g/mol. Its IUPAC name is 5,6-diethyl-3-(pyrrol-1-ylamino)pyridazine-4-carbonitrile.
| Compound Name | 5,6-diethyl-3-(pyrrol-1-ylamino)pyridazine-4-carbonitrile |
|---|---|
| PubChem CID | 80514429 |
| Molecular Formula | C13H15N5 |
| Molecular Weight | 241.30 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5,6-diethyl-3-(pyrrol-1-ylamino)pyridazine-4-carbonitrile |
| SMILES | CCc1nnc(Nn2cccc2)c(C#N)c1CC |
| InChI | InChI=1S/C13H15N5/c1-3-10-11(9-14)13(16-15-12(10)4-2)17-18-7-5-6-8-18/h5-8H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | WEFCLXVGIHFWKJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |