About 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid
2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid (PubChem CID 80516760) has the molecular formula C11H20N2O6S2
and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid |
| PubChem CID | 80516760 |
| Molecular Formula | C11H20N2O6S2 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid |
| SMILES | O=C(O)CC1CS(=O)(=O)CCN1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H20N2O6S2/c14-11(15)8-10-9-20(16,17)7-6-13(10)21(18,19)12-4-2-1-3-5-12/h10H,1-9H2,(H,14,15) |
| InChIKey | CQRHIWPGEMBBIS-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid?
The IUPAC name of 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid (CID 80516760) is 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid.
What is the SMILES notation for 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid?
The canonical SMILES for 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid is O=C(O)CC1CS(=O)(=O)CCN1S(=O)(=O)N1CCCCC1.
What is the InChIKey of 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid?
The InChIKey is CQRHIWPGEMBBIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O6S2/c14-11(15)8-10-9-20(16,17)7-6-13(10)21(18,19)12-4-2-1-3-5-12/h10H,1-9H2,(H,14,15).
What are the key properties of 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid?
2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid has a molecular weight of 340.42 g/mol, XLogP of -0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-dioxo-4-piperidin-1-ylsulfonyl-1,4-thiazinan-3-yl)acetic acid is sourced from PubChem (CID 80516760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).