C11H16N2O4 — CID 80547289
ethyl (E)-4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]but-2-enoate (PubChem CID 80547289) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is ethyl (E)-4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 80547289 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | ethyl (E)-4-[(1-methyl-2,5-dioxopyrrolidin-3-yl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CNC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C11H16N2O4/c1-3-17-10(15)5-4-6-12-8-7-9(14)13(2)11(8)16/h4-5,8,12H,3,6-7H2,1-2H3/b5-4+ |
| InChIKey | XVFYDJQWZGEVTB-SNAWJCMRSA-N |
| XLogP | -0.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|