C11H6FN5O2S — CID 80557048
4-fluoro-3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)benzoic acid (PubChem CID 80557048) has the molecular formula C11H6FN5O2S and a molecular weight of 291.27 g/mol. Its IUPAC name is 4-fluoro-3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)benzoic acid.
| Compound Name | 4-fluoro-3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 80557048 |
| Molecular Formula | C11H6FN5O2S |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 4-fluoro-3-(tetrazolo[1,5-a]pyrazin-5-ylsulfanyl)benzoic acid |
| SMILES | O=C(O)c1ccc(F)c(Sc2cncc3nnnn23)c1 |
| InChI | InChI=1S/C11H6FN5O2S/c12-7-2-1-6(11(18)19)3-8(7)20-10-5-13-4-9-14-15-16-17(9)10/h1-5H,(H,18,19) |
| InChIKey | VEGWGGZMJYUFOH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |