C15H23NO — CID 80562590
5-amino-1-(2-methylpentyl)-2,3-dihydroinden-1-ol (PubChem CID 80562590) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5-amino-1-(2-methylpentyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-(2-methylpentyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562590 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5-amino-1-(2-methylpentyl)-2,3-dihydroinden-1-ol |
| SMILES | CCCC(C)CC1(O)CCc2cc(N)ccc21 |
| InChI | InChI=1S/C15H23NO/c1-3-4-11(2)10-15(17)8-7-12-9-13(16)5-6-14(12)15/h5-6,9,11,17H,3-4,7-8,10,16H2,1-2H3 |
| InChIKey | ZHKPYEMTWOWZBH-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|