C15H17N3O — CID 80562688
5-amino-1-[(4-amino-3-pyridinyl)methyl]-2,3-dihydroinden-1-ol (PubChem CID 80562688) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is 5-amino-1-[(4-amino-3-pyridinyl)methyl]-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-[(4-amino-3-pyridinyl)methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562688 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 5-amino-1-[(4-amino-3-pyridinyl)methyl]-2,3-dihydroinden-1-ol |
| SMILES | Nc1ccc2c(c1)CCC2(O)Cc1cnccc1N |
| InChI | InChI=1S/C15H17N3O/c16-12-1-2-13-10(7-12)3-5-15(13,19)8-11-9-18-6-4-14(11)17/h1-2,4,6-7,9,19H,3,5,8,16H2,(H2,17,18) |
| InChIKey | NWNFHHTYBLRWIQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|