C16H15BrFNO — CID 80562868
5-amino-1-[(3-bromo-4-fluorophenyl)methyl]-2,3-dihydroinden-1-ol (PubChem CID 80562868) has the molecular formula C16H15BrFNO and a molecular weight of 336.20 g/mol. Its IUPAC name is 5-amino-1-[(3-bromo-4-fluorophenyl)methyl]-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-[(3-bromo-4-fluorophenyl)methyl]-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562868 |
| Molecular Formula | C16H15BrFNO |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 5-amino-1-[(3-bromo-4-fluorophenyl)methyl]-2,3-dihydroinden-1-ol |
| SMILES | Nc1ccc2c(c1)CCC2(O)Cc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C16H15BrFNO/c17-14-7-10(1-4-15(14)18)9-16(20)6-5-11-8-12(19)2-3-13(11)16/h1-4,7-8,20H,5-6,9,19H2 |
| InChIKey | WOSOZILNQRXDRQ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|