C14H15NOS — CID 80562844
5-amino-1-(thiophen-3-ylmethyl)-2,3-dihydroinden-1-ol (PubChem CID 80562844) has the molecular formula C14H15NOS and a molecular weight of 245.35 g/mol. Its IUPAC name is 5-amino-1-(thiophen-3-ylmethyl)-2,3-dihydroinden-1-ol.
| Compound Name | 5-amino-1-(thiophen-3-ylmethyl)-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 80562844 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 5-amino-1-(thiophen-3-ylmethyl)-2,3-dihydroinden-1-ol |
| SMILES | Nc1ccc2c(c1)CCC2(O)Cc1ccsc1 |
| InChI | InChI=1S/C14H15NOS/c15-12-1-2-13-11(7-12)3-5-14(13,16)8-10-4-6-17-9-10/h1-2,4,6-7,9,16H,3,5,8,15H2 |
| InChIKey | PXPAJXZVAAMFAD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|